Benzene and substituted derivatives
Filtered Search Results
3-Fluorosalicylic Acid 98.0+%, TCI America™
CAS: 341-27-5 Molecular Formula: C7H5FO3 Molecular Weight (g/mol): 156.112 MDL Number: MFCD00153167 InChI Key: GFHCXVJXSLGRJR-UHFFFAOYSA-N Synonym: 3-fluorosalicylic acid,benzoic acid, 3-fluoro-2-hydroxy,2-hydroxy-3-fluorobenzoic acid,3-fluoro-2-hydroxy-benzoic acid,salicylic acid, 3-fluoro,2-hydroxy-3-fluorobenzoicacid,3-fluoro-2-hydroxybenzoicacid,pubchem4960,acmc-1cjoo PubChem CID: 268724 IUPAC Name: 3-fluoro-2-hydroxybenzoic acid SMILES: C1=CC(=C(C(=C1)F)O)C(=O)O
| PubChem CID | 268724 |
|---|---|
| CAS | 341-27-5 |
| Molecular Weight (g/mol) | 156.112 |
| MDL Number | MFCD00153167 |
| SMILES | C1=CC(=C(C(=C1)F)O)C(=O)O |
| Synonym | 3-fluorosalicylic acid,benzoic acid, 3-fluoro-2-hydroxy,2-hydroxy-3-fluorobenzoic acid,3-fluoro-2-hydroxy-benzoic acid,salicylic acid, 3-fluoro,2-hydroxy-3-fluorobenzoicacid,3-fluoro-2-hydroxybenzoicacid,pubchem4960,acmc-1cjoo |
| IUPAC Name | 3-fluoro-2-hydroxybenzoic acid |
| InChI Key | GFHCXVJXSLGRJR-UHFFFAOYSA-N |
| Molecular Formula | C7H5FO3 |
4-(Trifluoromethyl)benzoyl Chloride 97.0+%, TCI America™
CAS: 329-15-7 Molecular Formula: C8H4ClF3O Molecular Weight (g/mol): 208.56 MDL Number: MFCD00000694 InChI Key: OXZYBOLWRXENKT-UHFFFAOYSA-N Synonym: 4-trifluoromethyl benzoyl chloride,p-trifluoromethyl benzoyl chloride,p-trifluoromethylbenzoyl chloride,benzoyl chloride, 4-trifluoromethyl,alpha,alpha,alpha-trifluoro-p-toluoyl chloride,4-trifluoromethyl benzoylchloride,p-trifluoromethyl benzoic acid chloride,ptf-boc,4-trifluoromethylbenzoylchloride,4-trifluoromethyl-benzoyl chloride PubChem CID: 67607 IUPAC Name: 4-(trifluoromethyl)benzoyl chloride SMILES: FC(F)(F)C1=CC=C(C=C1)C(Cl)=O
| PubChem CID | 67607 |
|---|---|
| CAS | 329-15-7 |
| Molecular Weight (g/mol) | 208.56 |
| MDL Number | MFCD00000694 |
| SMILES | FC(F)(F)C1=CC=C(C=C1)C(Cl)=O |
| Synonym | 4-trifluoromethyl benzoyl chloride,p-trifluoromethyl benzoyl chloride,p-trifluoromethylbenzoyl chloride,benzoyl chloride, 4-trifluoromethyl,alpha,alpha,alpha-trifluoro-p-toluoyl chloride,4-trifluoromethyl benzoylchloride,p-trifluoromethyl benzoic acid chloride,ptf-boc,4-trifluoromethylbenzoylchloride,4-trifluoromethyl-benzoyl chloride |
| IUPAC Name | 4-(trifluoromethyl)benzoyl chloride |
| InChI Key | OXZYBOLWRXENKT-UHFFFAOYSA-N |
| Molecular Formula | C8H4ClF3O |
alpha-Bromo-p-xylene 98.0+%, TCI America™
CAS: 104-81-4 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.064 MDL Number: MFCD00000181 InChI Key: WZRKSPFYXUXINF-UHFFFAOYSA-N Synonym: 4-methylbenzyl bromide,1-bromomethyl-4-methylbenzene,p-xylyl bromide,p-methylbenzyl bromide,alpha-bromo-p-xylene,benzene, 1-bromomethyl-4-methyl,4-bromomethyl toluene,p-bromomethyl toluene,alpha-bromo-p-xylol,1-bromomethyl-4-methyl-benzene PubChem CID: 7721 IUPAC Name: 1-(bromomethyl)-4-methylbenzene SMILES: CC1=CC=C(C=C1)CBr
| PubChem CID | 7721 |
|---|---|
| CAS | 104-81-4 |
| Molecular Weight (g/mol) | 185.064 |
| MDL Number | MFCD00000181 |
| SMILES | CC1=CC=C(C=C1)CBr |
| Synonym | 4-methylbenzyl bromide,1-bromomethyl-4-methylbenzene,p-xylyl bromide,p-methylbenzyl bromide,alpha-bromo-p-xylene,benzene, 1-bromomethyl-4-methyl,4-bromomethyl toluene,p-bromomethyl toluene,alpha-bromo-p-xylol,1-bromomethyl-4-methyl-benzene |
| IUPAC Name | 1-(bromomethyl)-4-methylbenzene |
| InChI Key | WZRKSPFYXUXINF-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
1,4-Bis(methoxymethyl)benzene 99.0+%, TCI America™
CAS: 6770-38-3 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00025903 InChI Key: DAJPMKAQEUGECW-UHFFFAOYSA-N Synonym: p-Xylene Glycol Dimethyl Ether PubChem CID: 81239 IUPAC Name: 1,4-bis(methoxymethyl)benzene SMILES: COCC1=CC=C(C=C1)COC
| PubChem CID | 81239 |
|---|---|
| CAS | 6770-38-3 |
| Molecular Weight (g/mol) | 166.22 |
| MDL Number | MFCD00025903 |
| SMILES | COCC1=CC=C(C=C1)COC |
| Synonym | p-Xylene Glycol Dimethyl Ether |
| IUPAC Name | 1,4-bis(methoxymethyl)benzene |
| InChI Key | DAJPMKAQEUGECW-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |
4-Benzyloxyphenylacetic Acid 98.0+%, TCI America™
CAS: 6547-53-1 Molecular Formula: C15H14O3 Molecular Weight (g/mol): 242.274 MDL Number: MFCD00017540 InChI Key: XJHGAJLIKDAOPE-UHFFFAOYSA-N Synonym: 4-benzyloxyphenylacetic acid,2-4-benzyloxy phenyl acetic acid,4-benzyloxy phenyl acetic acid,4-benzyloxyphenyl acetic acid,benzeneacetic acid, 4-phenylmethoxy,4-benzyloxy phenylacetic acid,4-benzyloxy-phenyl-acetic acid,2-4-phenylmethoxyphenyl acetic acid,2-4-phenylmethoxy phenyl acetic acid PubChem CID: 81033 IUPAC Name: 2-(4-phenylmethoxyphenyl)acetic acid SMILES: C1=CC=C(C=C1)COC2=CC=C(C=C2)CC(=O)O
| PubChem CID | 81033 |
|---|---|
| CAS | 6547-53-1 |
| Molecular Weight (g/mol) | 242.274 |
| MDL Number | MFCD00017540 |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CC(=O)O |
| Synonym | 4-benzyloxyphenylacetic acid,2-4-benzyloxy phenyl acetic acid,4-benzyloxy phenyl acetic acid,4-benzyloxyphenyl acetic acid,benzeneacetic acid, 4-phenylmethoxy,4-benzyloxy phenylacetic acid,4-benzyloxy-phenyl-acetic acid,2-4-phenylmethoxyphenyl acetic acid,2-4-phenylmethoxy phenyl acetic acid |
| IUPAC Name | 2-(4-phenylmethoxyphenyl)acetic acid |
| InChI Key | XJHGAJLIKDAOPE-UHFFFAOYSA-N |
| Molecular Formula | C15H14O3 |
1-Bromo-3,5-difluorobenzene 98.0+%, TCI America™
CAS: 461-96-1 Molecular Formula: C6H3BrF2 Molecular Weight (g/mol): 192.99 MDL Number: MFCD00010305 InChI Key: JHLKSIOJYMGSMB-UHFFFAOYSA-N Synonym: 3,5-difluorobromobenzene,1-bromo-3,5-difluoro-benzene,1-bromo-3,5-difluoro benzene,benzene, 1-bromo-3,5-difluoro,3,5-difluoro-bromobenzene,pubchem1042,acmc-1ae0k,3,5-difluoro bromobenzene,bromo-3,5-difluorobenzene,3,5-difluorophenyl bromide PubChem CID: 136313 IUPAC Name: 1-bromo-3,5-difluorobenzene SMILES: FC1=CC(Br)=CC(F)=C1
| PubChem CID | 136313 |
|---|---|
| CAS | 461-96-1 |
| Molecular Weight (g/mol) | 192.99 |
| MDL Number | MFCD00010305 |
| SMILES | FC1=CC(Br)=CC(F)=C1 |
| Synonym | 3,5-difluorobromobenzene,1-bromo-3,5-difluoro-benzene,1-bromo-3,5-difluoro benzene,benzene, 1-bromo-3,5-difluoro,3,5-difluoro-bromobenzene,pubchem1042,acmc-1ae0k,3,5-difluoro bromobenzene,bromo-3,5-difluorobenzene,3,5-difluorophenyl bromide |
| IUPAC Name | 1-bromo-3,5-difluorobenzene |
| InChI Key | JHLKSIOJYMGSMB-UHFFFAOYSA-N |
| Molecular Formula | C6H3BrF2 |
1-Bromo-3,4-difluorobenzene 98.0+%, TCI America™
CAS: 348-61-8 Molecular Formula: C6H3BrF2 Molecular Weight (g/mol): 192.99 MDL Number: MFCD00000304 InChI Key: YMQPKONILWWJQG-UHFFFAOYSA-N Synonym: 1-bromo-3,4-difluorobenzene,3,4-difluorobromobenzene,benzene, 4-bromo-1,2-difluoro,3,4-difluorobromebenzene,4-bromo-1,2-difluoro-benzene,3,4-difluoro-1-bromobenzene,paragos 390209,fr bf de,pubchem2303,3,4-difluorophenylbromide PubChem CID: 67675 IUPAC Name: 4-bromo-1,2-difluorobenzene SMILES: FC1=CC=C(Br)C=C1F
| PubChem CID | 67675 |
|---|---|
| CAS | 348-61-8 |
| Molecular Weight (g/mol) | 192.99 |
| MDL Number | MFCD00000304 |
| SMILES | FC1=CC=C(Br)C=C1F |
| Synonym | 1-bromo-3,4-difluorobenzene,3,4-difluorobromobenzene,benzene, 4-bromo-1,2-difluoro,3,4-difluorobromebenzene,4-bromo-1,2-difluoro-benzene,3,4-difluoro-1-bromobenzene,paragos 390209,fr bf de,pubchem2303,3,4-difluorophenylbromide |
| IUPAC Name | 4-bromo-1,2-difluorobenzene |
| InChI Key | YMQPKONILWWJQG-UHFFFAOYSA-N |
| Molecular Formula | C6H3BrF2 |
4-Bromobenzyl Alcohol 99.0+%, TCI America™
CAS: 873-75-6 Molecular Formula: C7H7BrO Molecular Weight (g/mol): 187.036 MDL Number: MFCD00004650 InChI Key: VEDDBHYQWFOITD-UHFFFAOYSA-N Synonym: 4-bromobenzyl alcohol,4-bromophenyl methanol,p-bromobenzyl alcohol,benzenemethanol, 4-bromo,para-bromobenzyl alcohol,4-bromobenzylalcohol,p-bromo-benzyl alcohol,ccris 5119,4-bromophenyl-methanol,benzyl alcohol, p-bromo PubChem CID: 70119 IUPAC Name: (4-bromophenyl)methanol SMILES: C1=CC(=CC=C1CO)Br
| PubChem CID | 70119 |
|---|---|
| CAS | 873-75-6 |
| Molecular Weight (g/mol) | 187.036 |
| MDL Number | MFCD00004650 |
| SMILES | C1=CC(=CC=C1CO)Br |
| Synonym | 4-bromobenzyl alcohol,4-bromophenyl methanol,p-bromobenzyl alcohol,benzenemethanol, 4-bromo,para-bromobenzyl alcohol,4-bromobenzylalcohol,p-bromo-benzyl alcohol,ccris 5119,4-bromophenyl-methanol,benzyl alcohol, p-bromo |
| IUPAC Name | (4-bromophenyl)methanol |
| InChI Key | VEDDBHYQWFOITD-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrO |
3,5-Bis(trifluoromethyl)benzaldehyde 95.0+%, TCI America™
CAS: 401-95-6 Molecular Formula: C9H4F6O Molecular Weight (g/mol): 242.12 MDL Number: MFCD00010206 InChI Key: LDWLIXZSDPXYDR-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl benzaldehyde,3,5-di trifluoromethyl benzaldehyde,mbt-bad,benzaldehyde, 3,5-bis trifluoromethyl,3,5-bis-trifluoromethyl-benzaldehyde,3,5-bis-trifluoromethyl benzaldehyde,pubchem4162,acmc-1ajhv,ksc490m1j PubChem CID: 136247 IUPAC Name: 3,5-bis(trifluoromethyl)benzaldehyde SMILES: C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C=O
| PubChem CID | 136247 |
|---|---|
| CAS | 401-95-6 |
| Molecular Weight (g/mol) | 242.12 |
| MDL Number | MFCD00010206 |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C=O |
| Synonym | 3,5-bis trifluoromethyl benzaldehyde,3,5-di trifluoromethyl benzaldehyde,mbt-bad,benzaldehyde, 3,5-bis trifluoromethyl,3,5-bis-trifluoromethyl-benzaldehyde,3,5-bis-trifluoromethyl benzaldehyde,pubchem4162,acmc-1ajhv,ksc490m1j |
| IUPAC Name | 3,5-bis(trifluoromethyl)benzaldehyde |
| InChI Key | LDWLIXZSDPXYDR-UHFFFAOYSA-N |
| Molecular Formula | C9H4F6O |
1,3-Bis(2-isocyanato-2-propyl)benzene 97.0+%, TCI America™
CAS: 2778-42-9 Molecular Formula: C14H16N2O2 Molecular Weight (g/mol): 244.294 MDL Number: MFCD00142493 InChI Key: AZYRZNIYJDKRHO-UHFFFAOYSA-N Synonym: 1,3-Bis(1-isocyanato-1-methylethyl)benzene PubChem CID: 17719 IUPAC Name: 1,3-bis(2-isocyanatopropan-2-yl)benzene SMILES: CC(C)(C1=CC(=CC=C1)C(C)(C)N=C=O)N=C=O
| PubChem CID | 17719 |
|---|---|
| CAS | 2778-42-9 |
| Molecular Weight (g/mol) | 244.294 |
| MDL Number | MFCD00142493 |
| SMILES | CC(C)(C1=CC(=CC=C1)C(C)(C)N=C=O)N=C=O |
| Synonym | 1,3-Bis(1-isocyanato-1-methylethyl)benzene |
| IUPAC Name | 1,3-bis(2-isocyanatopropan-2-yl)benzene |
| InChI Key | AZYRZNIYJDKRHO-UHFFFAOYSA-N |
| Molecular Formula | C14H16N2O2 |
4-(Chloromethyl)styrene (stabilized with TBC + ONP + 2-Nitro-p-cresol) 90.0+%, TCI America™
CAS: 1592-20-7 Molecular Formula: C9H9Cl Molecular Weight (g/mol): 152.62 MDL Number: MFCD00051362 InChI Key: ZRZHXNCATOYMJH-UHFFFAOYSA-N Synonym: 4-vinylbenzyl chloride,1-chloromethyl-4-vinylbenzene,4-chloromethylstyrene,4-vinylbenzylchloride,benzene, 1-chloromethyl-4-ethenyl,1-chloromethyl-4-ethenylbenzene,4-chloromethyl styrene,p-vinylbenzyl chloride,unii-cjl4oj6bs0,cjl4oj6bs0 PubChem CID: 74126 IUPAC Name: 1-(chloromethyl)-4-ethenylbenzene SMILES: ClCC1=CC=C(C=C)C=C1
| PubChem CID | 74126 |
|---|---|
| CAS | 1592-20-7 |
| Molecular Weight (g/mol) | 152.62 |
| MDL Number | MFCD00051362 |
| SMILES | ClCC1=CC=C(C=C)C=C1 |
| Synonym | 4-vinylbenzyl chloride,1-chloromethyl-4-vinylbenzene,4-chloromethylstyrene,4-vinylbenzylchloride,benzene, 1-chloromethyl-4-ethenyl,1-chloromethyl-4-ethenylbenzene,4-chloromethyl styrene,p-vinylbenzyl chloride,unii-cjl4oj6bs0,cjl4oj6bs0 |
| IUPAC Name | 1-(chloromethyl)-4-ethenylbenzene |
| InChI Key | ZRZHXNCATOYMJH-UHFFFAOYSA-N |
| Molecular Formula | C9H9Cl |
Ethylene Glycol Dibenzyl Ether 95.0+%, TCI America™
CAS: 622-22-0 Molecular Formula: C16H18O2 Molecular Weight (g/mol): 242.32 MDL Number: MFCD00030016 InChI Key: FPFHYKOBYMYVAN-UHFFFAOYSA-N Synonym: 1,2-Bis(benzyloxy)ethane, Dibenzyl Cellosolve, Dibenzyl Glycol, 1,2-Dibenzyloxyethane PubChem CID: 222542 IUPAC Name: {[2-(benzyloxy)ethoxy]methyl}benzene SMILES: C(COCC1=CC=CC=C1)OCC1=CC=CC=C1
| PubChem CID | 222542 |
|---|---|
| CAS | 622-22-0 |
| Molecular Weight (g/mol) | 242.32 |
| MDL Number | MFCD00030016 |
| SMILES | C(COCC1=CC=CC=C1)OCC1=CC=CC=C1 |
| Synonym | 1,2-Bis(benzyloxy)ethane, Dibenzyl Cellosolve, Dibenzyl Glycol, 1,2-Dibenzyloxyethane |
| IUPAC Name | {[2-(benzyloxy)ethoxy]methyl}benzene |
| InChI Key | FPFHYKOBYMYVAN-UHFFFAOYSA-N |
| Molecular Formula | C16H18O2 |
2-Hydroxy-4-n-octyloxybenzophenone 98.0+%, TCI America™
CAS: 1843-05-6 Molecular Formula: C21H26O3 Molecular Weight (g/mol): 326.436 MDL Number: MFCD00027327 InChI Key: QUAMTGJKVDWJEQ-UHFFFAOYSA-N Synonym: octabenzone,2-hydroxy-4-n-octyloxybenzophenone,benzophenone-12,2-hydroxy-4-octyloxy phenyl phenyl methanone,benzon oo,2-hydroxy-4-octyloxy benzophenone,benzophenone 12,cyasorb uv 531,spectra-sorb uv 531,sumisorb 130 PubChem CID: 15797 IUPAC Name: (2-hydroxy-4-octoxyphenyl)-phenylmethanone SMILES: CCCCCCCCOC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O
| PubChem CID | 15797 |
|---|---|
| CAS | 1843-05-6 |
| Molecular Weight (g/mol) | 326.436 |
| MDL Number | MFCD00027327 |
| SMILES | CCCCCCCCOC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O |
| Synonym | octabenzone,2-hydroxy-4-n-octyloxybenzophenone,benzophenone-12,2-hydroxy-4-octyloxy phenyl phenyl methanone,benzon oo,2-hydroxy-4-octyloxy benzophenone,benzophenone 12,cyasorb uv 531,spectra-sorb uv 531,sumisorb 130 |
| IUPAC Name | (2-hydroxy-4-octoxyphenyl)-phenylmethanone |
| InChI Key | QUAMTGJKVDWJEQ-UHFFFAOYSA-N |
| Molecular Formula | C21H26O3 |
1,3-Bis(trifluoromethyl)benzene 98.0+%, TCI America™
CAS: 402-31-3 Molecular Formula: C8H4F6 Molecular Weight (g/mol): 214.11 MDL Number: MFCD00000392 InChI Key: SJBBXFLOLUTGCW-UHFFFAOYSA-N Synonym: 1,3-bis trifluoromethyl benzene,benzene, 1,3-bis trifluoromethyl,1,3-di trifluoromethyl benzene,1,3-bis trifluoromethyl-benzene,m-bis trifluoromethyl benzene,m-ditrifluoromethylbenzene,hexafluoro-m-xylene,alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-m-xylene,mtf-tfm,a,a,a,a',a',a'-hexafluoro-m-xylene PubChem CID: 223106 IUPAC Name: 1,3-bis(trifluoromethyl)benzene SMILES: C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 223106 |
|---|---|
| CAS | 402-31-3 |
| Molecular Weight (g/mol) | 214.11 |
| MDL Number | MFCD00000392 |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 1,3-bis trifluoromethyl benzene,benzene, 1,3-bis trifluoromethyl,1,3-di trifluoromethyl benzene,1,3-bis trifluoromethyl-benzene,m-bis trifluoromethyl benzene,m-ditrifluoromethylbenzene,hexafluoro-m-xylene,alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-m-xylene,mtf-tfm,a,a,a,a',a',a'-hexafluoro-m-xylene |
| IUPAC Name | 1,3-bis(trifluoromethyl)benzene |
| InChI Key | SJBBXFLOLUTGCW-UHFFFAOYSA-N |
| Molecular Formula | C8H4F6 |
Methyl 4-Hydroxybenzoate 99.0+%, TCI America™
CAS: 99-76-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.149 MDL Number: MFCD00002352 InChI Key: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC Name: methyl 4-hydroxybenzoate SMILES: COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7456 |
|---|---|
| CAS | 99-76-3 |
| Molecular Weight (g/mol) | 152.149 |
| ChEBI | CHEBI:31835 |
| MDL Number | MFCD00002352 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| IUPAC Name | methyl 4-hydroxybenzoate |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |